C17H21NOS — CID 23432042
2-[4-[(E)-pent-2-enoxy]phenyl]-5-propyl-1,3-thiazole (PubChem CID 23432042) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-[4-[(E)-pent-2-enoxy]phenyl]-5-propyl-1,3-thiazole.
| Compound Name | 2-[4-[(E)-pent-2-enoxy]phenyl]-5-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 23432042 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-[4-[(E)-pent-2-enoxy]phenyl]-5-propyl-1,3-thiazole |
| SMILES | CC/C=C/COc1ccc(-c2ncc(CCC)s2)cc1 |
| InChI | InChI=1S/C17H21NOS/c1-3-5-6-12-19-15-10-8-14(9-11-15)17-18-13-16(20-17)7-4-2/h5-6,8-11,13H,3-4,7,12H2,1-2H3/b6-5+ |
| InChIKey | GMENMIRNFRHHDP-AATRIKPKSA-N |
| XLogP | 5.11 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|