C14H17NO2S — CID 157454552
3-[4-(5-ethyl-1,3-thiazol-2-yl)phenoxy]propan-1-ol (PubChem CID 157454552) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 3-[4-(5-ethyl-1,3-thiazol-2-yl)phenoxy]propan-1-ol.
| Compound Name | 3-[4-(5-ethyl-1,3-thiazol-2-yl)phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 157454552 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 3-[4-(5-ethyl-1,3-thiazol-2-yl)phenoxy]propan-1-ol |
| SMILES | CCc1cnc(-c2ccc(OCCCO)cc2)s1 |
| InChI | InChI=1S/C14H17NO2S/c1-2-13-10-15-14(18-13)11-4-6-12(7-5-11)17-9-3-8-16/h4-7,10,16H,2-3,8-9H2,1H3 |
| InChIKey | OJGCFGPMISVHBR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|