C29H35NO2S — CID 23432308
2,5-bis[4-[(E)-hept-2-enoxy]phenyl]-1,3-thiazole (PubChem CID 23432308) has the molecular formula C29H35NO2S and a molecular weight of 461.67 g/mol. Its IUPAC name is 2,5-bis[4-[(E)-hept-2-enoxy]phenyl]-1,3-thiazole.
| Compound Name | 2,5-bis[4-[(E)-hept-2-enoxy]phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 23432308 |
| Molecular Formula | C29H35NO2S |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 2,5-bis[4-[(E)-hept-2-enoxy]phenyl]-1,3-thiazole |
| SMILES | CCCC/C=C/COc1ccc(-c2cnc(-c3ccc(OC/C=C/CCCC)cc3)s2)cc1 |
| InChI | InChI=1S/C29H35NO2S/c1-3-5-7-9-11-21-31-26-17-13-24(14-18-26)28-23-30-29(33-28)25-15-19-27(20-16-25)32-22-12-10-8-6-4-2/h9-20,23H,3-8,21-22H2,1-2H3/b11-9+,12-10+ |
| InChIKey | UWDFPXDUCHOZAB-WGDLNXRISA-N |
| XLogP | 8.73 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|