C29H44N2O3 — CID 54389257
2-[4-(4-hexoxybutoxy)phenyl]-5-non-2-enoxypyrimidine (PubChem CID 54389257) has the molecular formula C29H44N2O3 and a molecular weight of 468.68 g/mol. Its IUPAC name is 2-[4-(4-hexoxybutoxy)phenyl]-5-non-2-enoxypyrimidine.
| Compound Name | 2-[4-(4-hexoxybutoxy)phenyl]-5-non-2-enoxypyrimidine |
|---|---|
| PubChem CID | 54389257 |
| Molecular Formula | C29H44N2O3 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.34 |
| IUPAC Name | 2-[4-(4-hexoxybutoxy)phenyl]-5-non-2-enoxypyrimidine |
| SMILES | CCCCCCC=CCOc1cnc(-c2ccc(OCCCCOCCCCCC)cc2)nc1 |
| InChI | InChI=1S/C29H44N2O3/c1-3-5-7-9-10-11-13-22-34-28-24-30-29(31-25-28)26-16-18-27(19-17-26)33-23-15-14-21-32-20-12-8-6-4-2/h11,13,16-19,24-25H,3-10,12,14-15,20-23H2,1-2H3 |
| InChIKey | VFLSVFZFFLTZGG-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|