C27H40N2O — CID 70269690
2-[4-[(Z)-non-5-enoxy]phenyl]-5-octylpyrimidine (PubChem CID 70269690) has the molecular formula C27H40N2O and a molecular weight of 408.63 g/mol. Its IUPAC name is 2-[4-[(Z)-non-5-enoxy]phenyl]-5-octylpyrimidine.
| Compound Name | 2-[4-[(Z)-non-5-enoxy]phenyl]-5-octylpyrimidine |
|---|---|
| PubChem CID | 70269690 |
| Molecular Formula | C27H40N2O |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | 2-[4-[(Z)-non-5-enoxy]phenyl]-5-octylpyrimidine |
| SMILES | CCC/C=C\CCCCOc1ccc(-c2ncc(CCCCCCCC)cn2)cc1 |
| InChI | InChI=1S/C27H40N2O/c1-3-5-7-9-11-13-15-21-30-26-19-17-25(18-20-26)27-28-22-24(23-29-27)16-14-12-10-8-6-4-2/h7,9,17-20,22-23H,3-6,8,10-16,21H2,1-2H3/b9-7- |
| InChIKey | COKGYBACBJUCIF-CLFYSBASSA-N |
| XLogP | 7.95 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|