About 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride
2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride (PubChem CID 158372966) has the molecular formula C22H32BF4N2O-
and a molecular weight of 427.32 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride.
Molecular Properties
| Compound Name | 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride |
| PubChem CID | 158372966 |
| Molecular Formula | C22H32BF4N2O- |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OCCCC)cc2)nc1.FB(F)F.[F-] |
| InChI | InChI=1S/C22H32N2O.BF3.FH/c1-3-5-7-8-9-10-11-19-17-23-22(24-18-19)20-12-14-21(15-13-20)25-16-6-4-2;2-1(3)4;/h12-15,17-18H,3-11,16H2,1-2H3;;1H/p-1 |
| InChIKey | GUVPJOGMUOVDLB-UHFFFAOYSA-M |
| XLogP | 4.11 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride?
The IUPAC name of 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride (CID 158372966) is 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride.
What is the SMILES notation for 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride?
The canonical SMILES for 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride is CCCCCCCCc1cnc(-c2ccc(OCCCC)cc2)nc1.FB(F)F.[F-].
What is the InChIKey of 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride?
The InChIKey is GUVPJOGMUOVDLB-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H32N2O.BF3.FH/c1-3-5-7-8-9-10-11-19-17-23-22(24-18-19)20-12-14-21(15-13-20)25-16-6-4-2;2-1(3)4;/h12-15,17-18H,3-11,16H2,1-2H3;;1H/p-1.
What are the key properties of 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride?
2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride has a molecular weight of 427.32 g/mol, XLogP of 4.11, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-butoxyphenyl)-5-octylpyrimidine;trifluoroborane;fluoride is sourced from PubChem (CID 158372966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).