C49H74N4O4 — CID 161112053
5-decyl-2-[4-(2-propoxyethoxy)phenyl]pyrimidine;5-nonyl-2-[4-(2-propoxyethoxy)phenyl]pyrimidine (PubChem CID 161112053) has the molecular formula C49H74N4O4 and a molecular weight of 783.15 g/mol. Its IUPAC name is 5-decyl-2-[4-(2-propoxyethoxy)phenyl]pyrimidine;5-nonyl-2-[4-(2-propoxyethoxy)phenyl]pyrimidine.
| Compound Name | 5-decyl-2-[4-(2-propoxyethoxy)phenyl]pyrimidine;5-nonyl-2-[4-(2-propoxyethoxy)phenyl]pyrimidine |
|---|---|
| PubChem CID | 161112053 |
| Molecular Formula | C49H74N4O4 |
| Molecular Weight | 783.15 g/mol |
| Exact Mass | 782.57 |
| IUPAC Name | 5-decyl-2-[4-(2-propoxyethoxy)phenyl]pyrimidine;5-nonyl-2-[4-(2-propoxyethoxy)phenyl]pyrimidine |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(OCCOCCC)cc2)nc1.CCCCCCCCCc1cnc(-c2ccc(OCCOCCC)cc2)nc1 |
| InChI | InChI=1S/C25H38N2O2.C24H36N2O2/c1-3-5-6-7-8-9-10-11-12-22-20-26-25(27-21-22)23-13-15-24(16-14-23)29-19-18-28-17-4-2;1-3-5-6-7-8-9-10-11-21-19-25-24(26-20-21)22-12-14-23(15-13-22)28-18-17-27-16-4-2/h13-16,20-21H,3-12,17-19H2,1-2H3;12-15,19-20H,3-11,16-18H2,1-2H3 |
| InChIKey | UJUYKJPIPGWEOF-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 88.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.15 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|