C27H42N2O2 — CID 18611646
2-[4-[4-[(2S)-2-methylbutoxy]butoxy]phenyl]-5-octylpyrimidine (PubChem CID 18611646) has the molecular formula C27H42N2O2 and a molecular weight of 426.65 g/mol. Its IUPAC name is 2-[4-[4-[(2S)-2-methylbutoxy]butoxy]phenyl]-5-octylpyrimidine.
| Compound Name | 2-[4-[4-[(2S)-2-methylbutoxy]butoxy]phenyl]-5-octylpyrimidine |
|---|---|
| PubChem CID | 18611646 |
| Molecular Formula | C27H42N2O2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | 2-[4-[4-[(2S)-2-methylbutoxy]butoxy]phenyl]-5-octylpyrimidine |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OCCCCOC[C@@H](C)CC)cc2)nc1 |
| InChI | InChI=1S/C27H42N2O2/c1-4-6-7-8-9-10-13-24-20-28-27(29-21-24)25-14-16-26(17-15-25)31-19-12-11-18-30-22-23(3)5-2/h14-17,20-21,23H,4-13,18-19,22H2,1-3H3/t23-/m0/s1 |
| InChIKey | AFOGEWTUYQJZSE-QHCPKHFHSA-N |
| XLogP | 7.27 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|