C62H82N4O3 — CID 88523237
2-[4-[[4-(2-methylbutoxy)phenyl]-[[4-(2-methylbutoxy)phenyl]-[4-(5-nonylpyrimidin-2-yl)phenyl]methoxy]methyl]phenyl]-5-nonylpyrimidine (PubChem CID 88523237) has the molecular formula C62H82N4O3 and a molecular weight of 931.36 g/mol. Its IUPAC name is 2-[4-[[4-(2-methylbutoxy)phenyl]-[[4-(2-methylbutoxy)phenyl]-[4-(5-nonylpyrimidin-2-yl)phenyl]methoxy]methyl]phenyl]-5-nonylpyrimidine.
| Compound Name | 2-[4-[[4-(2-methylbutoxy)phenyl]-[[4-(2-methylbutoxy)phenyl]-[4-(5-nonylpyrimidin-2-yl)phenyl]methoxy]methyl]phenyl]-5-nonylpyrimidine |
|---|---|
| PubChem CID | 88523237 |
| Molecular Formula | C62H82N4O3 |
| Molecular Weight | 931.36 g/mol |
| Exact Mass | 930.64 |
| IUPAC Name | 2-[4-[[4-(2-methylbutoxy)phenyl]-[[4-(2-methylbutoxy)phenyl]-[4-(5-nonylpyrimidin-2-yl)phenyl]methoxy]methyl]phenyl]-5-nonylpyrimidine |
| SMILES | CCCCCCCCCc1cnc(-c2ccc(C(OC(c3ccc(OCC(C)CC)cc3)c3ccc(-c4ncc(CCCCCCCCC)cn4)cc3)c3ccc(OCC(C)CC)cc3)cc2)nc1 |
| InChI | InChI=1S/C62H82N4O3/c1-7-11-13-15-17-19-21-23-49-41-63-61(64-42-49)55-29-25-51(26-30-55)59(53-33-37-57(38-34-53)67-45-47(5)9-3)69-60(54-35-39-58(40-36-54)68-46-48(6)10-4)52-27-31-56(32-28-52)62-65-43-50(44-66-62)24-22-20-18-16-14-12-8-2/h25-44,47-48,59-60H,7-24,45-46H2,1-6H3 |
| InChIKey | SAZKGEINFHTBNL-UHFFFAOYSA-N |
| XLogP | 16.93 |
| TPSA | 79.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.36 |
| LogP ≤ 5 | 16.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|