C66H86N4O5 — CID 57133961
2-methylbutyl 4-[[4-(5-decylpyrimidin-2-yl)phenyl]-[[4-(5-decylpyrimidin-2-yl)phenyl]-[4-(2-methylbutoxycarbonyl)phenyl]methoxy]methyl]benzoate (PubChem CID 57133961) has the molecular formula C66H86N4O5 and a molecular weight of 1015.44 g/mol. Its IUPAC name is 2-methylbutyl 4-[[4-(5-decylpyrimidin-2-yl)phenyl]-[[4-(5-decylpyrimidin-2-yl)phenyl]-[4-(2-methylbutoxycarbonyl)phenyl]methoxy]methyl]benzoate.
| Compound Name | 2-methylbutyl 4-[[4-(5-decylpyrimidin-2-yl)phenyl]-[[4-(5-decylpyrimidin-2-yl)phenyl]-[4-(2-methylbutoxycarbonyl)phenyl]methoxy]methyl]benzoate |
|---|---|
| PubChem CID | 57133961 |
| Molecular Formula | C66H86N4O5 |
| Molecular Weight | 1015.44 g/mol |
| Exact Mass | 1014.66 |
| IUPAC Name | 2-methylbutyl 4-[[4-(5-decylpyrimidin-2-yl)phenyl]-[[4-(5-decylpyrimidin-2-yl)phenyl]-[4-(2-methylbutoxycarbonyl)phenyl]methoxy]methyl]benzoate |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(C(OC(c3ccc(C(=O)OCC(C)CC)cc3)c3ccc(-c4ncc(CCCCCCCCCC)cn4)cc3)c3ccc(C(=O)OCC(C)CC)cc3)cc2)nc1 |
| InChI | InChI=1S/C66H86N4O5/c1-7-11-13-15-17-19-21-23-25-51-43-67-63(68-44-51)57-35-27-53(28-36-57)61(55-31-39-59(40-32-55)65(71)73-47-49(5)9-3)75-62(56-33-41-60(42-34-56)66(72)74-48-50(6)10-4)54-29-37-58(38-30-54)64-69-45-52(46-70-64)26-24-22-20-18-16-14-12-8-2/h27-46,49-50,61-62H,7-26,47-48H2,1-6H3 |
| InChIKey | XBKPFYLCZAYPCZ-UHFFFAOYSA-N |
| XLogP | 17.27 |
| TPSA | 113.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.44 |
| LogP ≤ 5 | 17.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|