C24H34N2O3 — CID 20667892
2-methylbutyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate (PubChem CID 20667892) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 2-methylbutyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate.
| Compound Name | 2-methylbutyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 20667892 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 2-methylbutyl 2-(4-octoxyphenyl)pyrimidine-5-carboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2ncc(C(=O)OCC(C)CC)cn2)cc1 |
| InChI | InChI=1S/C24H34N2O3/c1-4-6-7-8-9-10-15-28-22-13-11-20(12-14-22)23-25-16-21(17-26-23)24(27)29-18-19(3)5-2/h11-14,16-17,19H,4-10,15,18H2,1-3H3 |
| InChIKey | ZXNIPCDZMARLLZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|