C28H36O3 — CID 102437385
[(2S)-2-methylbutyl] 4-[2-(4-octoxyphenyl)ethynyl]benzoate (PubChem CID 102437385) has the molecular formula C28H36O3 and a molecular weight of 420.59 g/mol. Its IUPAC name is [(2S)-2-methylbutyl] 4-[2-(4-octoxyphenyl)ethynyl]benzoate.
| Compound Name | [(2S)-2-methylbutyl] 4-[2-(4-octoxyphenyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 102437385 |
| Molecular Formula | C28H36O3 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | [(2S)-2-methylbutyl] 4-[2-(4-octoxyphenyl)ethynyl]benzoate |
| SMILES | CCCCCCCCOc1ccc(C#Cc2ccc(C(=O)OC[C@@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C28H36O3/c1-4-6-7-8-9-10-21-30-27-19-15-25(16-20-27)12-11-24-13-17-26(18-14-24)28(29)31-22-23(3)5-2/h13-20,23H,4-10,21-22H2,1-3H3/t23-/m0/s1 |
| InChIKey | VEQTWXOBBGJYIN-QHCPKHFHSA-N |
| XLogP | 7.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|