C29H36O4 — CID 14847649
[(2R)-2-methylbutyl] 4-[(6-hexoxynaphthalen-2-yl)oxymethyl]benzoate (PubChem CID 14847649) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is [(2R)-2-methylbutyl] 4-[(6-hexoxynaphthalen-2-yl)oxymethyl]benzoate.
| Compound Name | [(2R)-2-methylbutyl] 4-[(6-hexoxynaphthalen-2-yl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 14847649 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | [(2R)-2-methylbutyl] 4-[(6-hexoxynaphthalen-2-yl)oxymethyl]benzoate |
| SMILES | CCCCCCOc1ccc2cc(OCc3ccc(C(=O)OC[C@H](C)CC)cc3)ccc2c1 |
| InChI | InChI=1S/C29H36O4/c1-4-6-7-8-17-31-27-15-13-26-19-28(16-14-25(26)18-27)32-21-23-9-11-24(12-10-23)29(30)33-20-22(3)5-2/h9-16,18-19,22H,4-8,17,20-21H2,1-3H3/t22-/m1/s1 |
| InChIKey | KOIUVNFODKWCTB-JOCHJYFZSA-N |
| XLogP | 7.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|