C41H52O4 — CID 102327755
pentyl (2S)-2-[6-[[4-(4-decoxyphenyl)phenyl]methoxy]naphthalen-2-yl]propanoate (PubChem CID 102327755) has the molecular formula C41H52O4 and a molecular weight of 608.86 g/mol. Its IUPAC name is pentyl (2S)-2-[6-[[4-(4-decoxyphenyl)phenyl]methoxy]naphthalen-2-yl]propanoate.
| Compound Name | pentyl (2S)-2-[6-[[4-(4-decoxyphenyl)phenyl]methoxy]naphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 102327755 |
| Molecular Formula | C41H52O4 |
| Molecular Weight | 608.86 g/mol |
| Exact Mass | 608.39 |
| IUPAC Name | pentyl (2S)-2-[6-[[4-(4-decoxyphenyl)phenyl]methoxy]naphthalen-2-yl]propanoate |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(COc3ccc4cc([C@H](C)C(=O)OCCCCC)ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C41H52O4/c1-4-6-8-9-10-11-12-14-27-43-39-24-21-35(22-25-39)34-17-15-33(16-18-34)31-45-40-26-23-37-29-36(19-20-38(37)30-40)32(3)41(42)44-28-13-7-5-2/h15-26,29-30,32H,4-14,27-28,31H2,1-3H3/t32-/m0/s1 |
| InChIKey | PDIUOOHRXRXXCQ-YTTGMZPUSA-N |
| XLogP | 11.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.86 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|