C41H44O5 — CID 15086674
ethyl (2S)-2-[6-[6-[3,4-bis(phenylmethoxy)phenyl]hexoxy]naphthalen-2-yl]propanoate (PubChem CID 15086674) has the molecular formula C41H44O5 and a molecular weight of 616.80 g/mol. Its IUPAC name is ethyl (2S)-2-[6-[6-[3,4-bis(phenylmethoxy)phenyl]hexoxy]naphthalen-2-yl]propanoate.
| Compound Name | ethyl (2S)-2-[6-[6-[3,4-bis(phenylmethoxy)phenyl]hexoxy]naphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 15086674 |
| Molecular Formula | C41H44O5 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | ethyl (2S)-2-[6-[6-[3,4-bis(phenylmethoxy)phenyl]hexoxy]naphthalen-2-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)c1ccc2cc(OCCCCCCc3ccc(OCc4ccccc4)c(OCc4ccccc4)c3)ccc2c1 |
| InChI | InChI=1S/C41H44O5/c1-3-43-41(42)31(2)35-20-21-37-28-38(23-22-36(37)27-35)44-25-13-5-4-8-14-32-19-24-39(45-29-33-15-9-6-10-16-33)40(26-32)46-30-34-17-11-7-12-18-34/h6-7,9-12,15-24,26-28,31H,3-5,8,13-14,25,29-30H2,1-2H3/t31-/m0/s1 |
| InChIKey | ABRROKYIHOBNEV-HKBQPEDESA-N |
| XLogP | 9.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|