C25H28O5 — CID 15086676
(2S)-2-[6-[6-(3,4-dihydroxyphenyl)hexoxy]naphthalen-2-yl]propanoic acid (PubChem CID 15086676) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is (2S)-2-[6-[6-(3,4-dihydroxyphenyl)hexoxy]naphthalen-2-yl]propanoic acid.
| Compound Name | (2S)-2-[6-[6-(3,4-dihydroxyphenyl)hexoxy]naphthalen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 15086676 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (2S)-2-[6-[6-(3,4-dihydroxyphenyl)hexoxy]naphthalen-2-yl]propanoic acid |
| SMILES | C[C@H](C(=O)O)c1ccc2cc(OCCCCCCc3ccc(O)c(O)c3)ccc2c1 |
| InChI | InChI=1S/C25H28O5/c1-17(25(28)29)19-8-9-21-16-22(11-10-20(21)15-19)30-13-5-3-2-4-6-18-7-12-23(26)24(27)14-18/h7-12,14-17,26-27H,2-6,13H2,1H3,(H,28,29)/t17-/m0/s1 |
| InChIKey | DZDMLHURVBARLF-KRWDZBQOSA-N |
| XLogP | 5.62 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|