About potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid
potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid (PubChem CID 174215246) has the molecular formula C14H15KO3
and a molecular weight of 270.37 g/mol. Its IUPAC name is potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid.
Molecular Properties
| Compound Name | potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid |
| PubChem CID | 174215246 |
| Molecular Formula | C14H15KO3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid |
| SMILES | COc1ccc2cc(C(C)C(=O)O)ccc2c1.[H-].[K+] |
| InChI | InChI=1S/C14H14O3.K.H/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10;;/h3-9H,1-2H3,(H,15,16);;/q;+1;-1 |
| InChIKey | YMLBQYFWQCJEDA-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid?
The IUPAC name of potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid (CID 174215246) is potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid.
What is the SMILES notation for potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid?
The canonical SMILES for potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid is COc1ccc2cc(C(C)C(=O)O)ccc2c1.[H-].[K+].
What is the InChIKey of potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid?
The InChIKey is YMLBQYFWQCJEDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3.K.H/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10;;/h3-9H,1-2H3,(H,15,16);;/q;+1;-1.
What are the key properties of potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid?
potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid has a molecular weight of 270.37 g/mol, XLogP of 0.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;2-(6-methoxynaphthalen-2-yl)propanoic acid is sourced from PubChem (CID 174215246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).