C18H19NO6 — CID 131744188
1-hydroxypyrrolidine-2,5-dione;(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid (PubChem CID 131744188) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid.
| Compound Name | 1-hydroxypyrrolidine-2,5-dione;(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 131744188 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione;(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid |
| SMILES | COc1ccc2cc([C@H](C)C(=O)O)ccc2c1.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C14H14O3.C4H5NO3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10;6-3-1-2-4(7)5(3)8/h3-9H,1-2H3,(H,15,16);8H,1-2H2/t9-;/m0./s1 |
| InChIKey | OADGQXCXGMXDCB-FVGYRXGTSA-N |
| XLogP | 2.56 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|