About bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine
bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine (PubChem CID 76968825) has the molecular formula C32H38N2O6
and a molecular weight of 546.66 g/mol. Its IUPAC name is bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine.
Molecular Properties
| Compound Name | bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine |
| PubChem CID | 76968825 |
| Molecular Formula | C32H38N2O6 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine |
| SMILES | C1CNCCN1.COc1ccc2cc([C@H](C)C(=O)O)ccc2c1.COc1ccc2cc([C@H](C)C(=O)O)ccc2c1 |
| InChI | InChI=1S/2C14H14O3.C4H10N2/c2*1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10;1-2-6-4-3-5-1/h2*3-9H,1-2H3,(H,15,16);5-6H,1-4H2/t2*9-;/m00./s1 |
| InChIKey | KRDCGZGYWRCHNN-NAWJVIAPSA-N |
| XLogP | 5.25 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine?
The IUPAC name of bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine (CID 76968825) is bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine.
What is the SMILES notation for bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine?
The canonical SMILES for bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine is C1CNCCN1.COc1ccc2cc([C@H](C)C(=O)O)ccc2c1.COc1ccc2cc([C@H](C)C(=O)O)ccc2c1.
What is the InChIKey of bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine?
The InChIKey is KRDCGZGYWRCHNN-NAWJVIAPSA-N. The full InChI is InChI=1S/2C14H14O3.C4H10N2/c2*1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10;1-2-6-4-3-5-1/h2*3-9H,1-2H3,(H,15,16);5-6H,1-4H2/t2*9-;/m00./s1.
What are the key properties of bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine?
bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine has a molecular weight of 546.66 g/mol, XLogP of 5.25, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid);piperazine is sourced from PubChem (CID 76968825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).