C13H12O6S — CID 102017270
(2R)-2-(6-sulfooxynaphthalen-2-yl)propanoic acid (PubChem CID 102017270) has the molecular formula C13H12O6S and a molecular weight of 296.30 g/mol. Its IUPAC name is (2R)-2-(6-sulfooxynaphthalen-2-yl)propanoic acid.
| Compound Name | (2R)-2-(6-sulfooxynaphthalen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 102017270 |
| Molecular Formula | C13H12O6S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | (2R)-2-(6-sulfooxynaphthalen-2-yl)propanoic acid |
| SMILES | C[C@@H](C(=O)O)c1ccc2cc(OS(=O)(=O)O)ccc2c1 |
| InChI | InChI=1S/C13H12O6S/c1-8(13(14)15)9-2-3-11-7-12(19-20(16,17)18)5-4-10(11)6-9/h2-8H,1H3,(H,14,15)(H,16,17,18)/t8-/m1/s1 |
| InChIKey | BNKMSCMOWGCUOF-MRVPVSSYSA-N |
| XLogP | 2.21 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|