C23H25NO5 — CID 121437225
ethyl 4-aminobenzoate;(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid (PubChem CID 121437225) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl 4-aminobenzoate;(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid.
| Compound Name | ethyl 4-aminobenzoate;(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 121437225 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | ethyl 4-aminobenzoate;(2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid |
| SMILES | CCOC(=O)c1ccc(N)cc1.COc1ccc2cc([C@H](C)C(=O)O)ccc2c1 |
| InChI | InChI=1S/C14H14O3.C9H11NO2/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10;1-2-12-9(11)7-3-5-8(10)6-4-7/h3-9H,1-2H3,(H,15,16);3-6H,2,10H2,1H3/t9-;/m0./s1 |
| InChIKey | GKDWNDUPKHBANL-FVGYRXGTSA-N |
| XLogP | 4.48 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|