About ethyl 4-methoxybenzoate;hydrochloride
ethyl 4-methoxybenzoate;hydrochloride (PubChem CID 143432301) has the molecular formula C10H13ClO3
and a molecular weight of 216.66 g/mol. Its IUPAC name is ethyl 4-methoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 4-methoxybenzoate;hydrochloride |
| PubChem CID | 143432301 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | ethyl 4-methoxybenzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C10H12O3.ClH/c1-3-13-10(11)8-4-6-9(12-2)7-5-8;/h4-7H,3H2,1-2H3;1H |
| InChIKey | ZZFFHTCRJUIDJT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-methoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methoxybenzoate;hydrochloride?
The IUPAC name of ethyl 4-methoxybenzoate;hydrochloride (CID 143432301) is ethyl 4-methoxybenzoate;hydrochloride.
What is the SMILES notation for ethyl 4-methoxybenzoate;hydrochloride?
The canonical SMILES for ethyl 4-methoxybenzoate;hydrochloride is CCOC(=O)c1ccc(OC)cc1.Cl.
What is the InChIKey of ethyl 4-methoxybenzoate;hydrochloride?
The InChIKey is ZZFFHTCRJUIDJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3.ClH/c1-3-13-10(11)8-4-6-9(12-2)7-5-8;/h4-7H,3H2,1-2H3;1H.
What are the key properties of ethyl 4-methoxybenzoate;hydrochloride?
ethyl 4-methoxybenzoate;hydrochloride has a molecular weight of 216.66 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methoxybenzoate;hydrochloride is sourced from PubChem (CID 143432301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).