C21H26N3O5+ — CID 9222883
[2-(4-ethoxycarbonylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 9222883) has the molecular formula C21H26N3O5+ and a molecular weight of 400.46 g/mol. Its IUPAC name is [2-(4-ethoxycarbonylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(4-ethoxycarbonylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9222883 |
| Molecular Formula | C21H26N3O5+ |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [2-(4-ethoxycarbonylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | CCOC(=O)c1ccc(NC(=O)C[NH+](C)CC(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O5/c1-4-29-21(27)15-5-7-16(8-6-15)22-19(25)13-24(2)14-20(26)23-17-9-11-18(28-3)12-10-17/h5-12H,4,13-14H2,1-3H3,(H,22,25)(H,23,26)/p+1 |
| InChIKey | PPBHOTXREXKGQJ-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |