C22H30N3O3+ — CID 2658341
[2-(4-butylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 2658341) has the molecular formula C22H30N3O3+ and a molecular weight of 384.50 g/mol. Its IUPAC name is [2-(4-butylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(4-butylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 2658341 |
| Molecular Formula | C22H30N3O3+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [2-(4-butylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | CCCCc1ccc(NC(=O)C[NH+](C)CC(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H29N3O3/c1-4-5-6-17-7-9-18(10-8-17)23-21(26)15-25(2)16-22(27)24-19-11-13-20(28-3)14-12-19/h7-14H,4-6,15-16H2,1-3H3,(H,23,26)(H,24,27)/p+1 |
| InChIKey | MEPGQURTQCWDGF-UHFFFAOYSA-O |
| XLogP | 2.13 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |