C20H24N3O4+ — CID 9222899
[2-(4-acetylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 9222899) has the molecular formula C20H24N3O4+ and a molecular weight of 370.43 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9222899 |
| Molecular Formula | C20H24N3O4+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl]-[2-(4-methoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(NC(=O)C[NH+](C)CC(=O)Nc2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C20H23N3O4/c1-14(24)15-4-6-16(7-5-15)21-19(25)12-23(2)13-20(26)22-17-8-10-18(27-3)11-9-17/h4-11H,12-13H2,1-3H3,(H,21,25)(H,22,26)/p+1 |
| InChIKey | CHIOJYKHVNAVHY-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |