C17H17NO4 — CID 23763529
N,3-bis(4-methoxyphenyl)-3-oxopropanamide (PubChem CID 23763529) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is N,3-bis(4-methoxyphenyl)-3-oxopropanamide.
| Compound Name | N,3-bis(4-methoxyphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 23763529 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N,3-bis(4-methoxyphenyl)-3-oxopropanamide |
| SMILES | COc1ccc(NC(=O)CC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H17NO4/c1-21-14-7-3-12(4-8-14)16(19)11-17(20)18-13-5-9-15(22-2)10-6-13/h3-10H,11H2,1-2H3,(H,18,20) |
| InChIKey | WAGBJUSSHSDKAE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|