C18H17NO5 — CID 6424832
N,4-bis(4-methoxyphenyl)-2,4-dioxobutanamide (PubChem CID 6424832) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is N,4-bis(4-methoxyphenyl)-2,4-dioxobutanamide.
| Compound Name | N,4-bis(4-methoxyphenyl)-2,4-dioxobutanamide |
|---|---|
| PubChem CID | 6424832 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N,4-bis(4-methoxyphenyl)-2,4-dioxobutanamide |
| SMILES | COc1ccc(NC(=O)C(=O)CC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H17NO5/c1-23-14-7-3-12(4-8-14)16(20)11-17(21)18(22)19-13-5-9-15(24-2)10-6-13/h3-10H,11H2,1-2H3,(H,19,22) |
| InChIKey | OBNJZFGWKGVCKL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|