C17H16N2O4 — CID 3075421
4-(4-methoxyphenyl)-N-(6-methyl-2-pyridinyl)-2,4-dioxobutanamide (PubChem CID 3075421) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-(6-methyl-2-pyridinyl)-2,4-dioxobutanamide.
| Compound Name | 4-(4-methoxyphenyl)-N-(6-methyl-2-pyridinyl)-2,4-dioxobutanamide |
|---|---|
| PubChem CID | 3075421 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-(6-methyl-2-pyridinyl)-2,4-dioxobutanamide |
| SMILES | COc1ccc(C(=O)CC(=O)C(=O)Nc2cccc(C)n2)cc1 |
| InChI | InChI=1S/C17H16N2O4/c1-11-4-3-5-16(18-11)19-17(22)15(21)10-14(20)12-6-8-13(23-2)9-7-12/h3-9H,10H2,1-2H3,(H,18,19,22) |
| InChIKey | PJDFWTPHEIOQJM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|