C19H17NO6 — CID 177254221
methyl 2-[[4-(4-methoxyphenyl)-2,4-dioxobutanoyl]amino]benzoate (PubChem CID 177254221) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is methyl 2-[[4-(4-methoxyphenyl)-2,4-dioxobutanoyl]amino]benzoate.
| Compound Name | methyl 2-[[4-(4-methoxyphenyl)-2,4-dioxobutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 177254221 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | methyl 2-[[4-(4-methoxyphenyl)-2,4-dioxobutanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(=O)CC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H17NO6/c1-25-13-9-7-12(8-10-13)16(21)11-17(22)18(23)20-15-6-4-3-5-14(15)19(24)26-2/h3-10H,11H2,1-2H3,(H,20,23) |
| InChIKey | CTNGKLUBLSSENJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|