C19H18N2O6 — CID 108501747
methyl 2-[[2-(2-ethoxycarbonylanilino)-2-oxoacetyl]amino]benzoate (PubChem CID 108501747) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is methyl 2-[[2-(2-ethoxycarbonylanilino)-2-oxoacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(2-ethoxycarbonylanilino)-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108501747 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | methyl 2-[[2-(2-ethoxycarbonylanilino)-2-oxoacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C(=O)Nc1ccccc1C(=O)OC |
| InChI | InChI=1S/C19H18N2O6/c1-3-27-19(25)13-9-5-7-11-15(13)21-17(23)16(22)20-14-10-6-4-8-12(14)18(24)26-2/h4-11H,3H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | ZRKVCUDKSMMUGT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|