C19H20N2O5 — CID 108501758
ethyl 2-[[2-(4-ethoxyanilino)-2-oxoacetyl]amino]benzoate (PubChem CID 108501758) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is ethyl 2-[[2-(4-ethoxyanilino)-2-oxoacetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(4-ethoxyanilino)-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108501758 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | ethyl 2-[[2-(4-ethoxyanilino)-2-oxoacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C(=O)Nc1ccc(OCC)cc1 |
| InChI | InChI=1S/C19H20N2O5/c1-3-25-14-11-9-13(10-12-14)20-17(22)18(23)21-16-8-6-5-7-15(16)19(24)26-4-2/h5-12H,3-4H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | FNGQVVJGYSSRGI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|