C19H19NO5 — CID 126458118
N-(4-ethoxyphenyl)-4-(4-methoxyphenyl)-2,4-dioxobutanamide (PubChem CID 126458118) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-(4-methoxyphenyl)-2,4-dioxobutanamide.
| Compound Name | N-(4-ethoxyphenyl)-4-(4-methoxyphenyl)-2,4-dioxobutanamide |
|---|---|
| PubChem CID | 126458118 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-(4-methoxyphenyl)-2,4-dioxobutanamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)CC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H19NO5/c1-3-25-16-10-6-14(7-11-16)20-19(23)18(22)12-17(21)13-4-8-15(24-2)9-5-13/h4-11H,3,12H2,1-2H3,(H,20,23) |
| InChIKey | WIJPOBCNBUDPSA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|