C13H14O5 — CID 3803733
methyl 4-(4-ethoxyphenyl)-2,4-dioxobutanoate (PubChem CID 3803733) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is methyl 4-(4-ethoxyphenyl)-2,4-dioxobutanoate.
| Compound Name | methyl 4-(4-ethoxyphenyl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 3803733 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | methyl 4-(4-ethoxyphenyl)-2,4-dioxobutanoate |
| SMILES | CCOc1ccc(C(=O)CC(=O)C(=O)OC)cc1 |
| InChI | InChI=1S/C13H14O5/c1-3-18-10-6-4-9(5-7-10)11(14)8-12(15)13(16)17-2/h4-7H,3,8H2,1-2H3 |
| InChIKey | PFPBZQIEMJJXBN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|