C14H16O6 — CID 154024614
methyl 4-(3-ethoxy-5-methoxyphenyl)-2,4-dioxobutanoate (PubChem CID 154024614) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 4-(3-ethoxy-5-methoxyphenyl)-2,4-dioxobutanoate.
| Compound Name | methyl 4-(3-ethoxy-5-methoxyphenyl)-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 154024614 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | methyl 4-(3-ethoxy-5-methoxyphenyl)-2,4-dioxobutanoate |
| SMILES | CCOc1cc(OC)cc(C(=O)CC(=O)C(=O)OC)c1 |
| InChI | InChI=1S/C14H16O6/c1-4-20-11-6-9(5-10(7-11)18-2)12(15)8-13(16)14(17)19-3/h5-7H,4,8H2,1-3H3 |
| InChIKey | MYKMNYQYZMBAKF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|