C12H11F3O4 — CID 129319908
1-(3,5-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione (PubChem CID 129319908) has the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione.
| Compound Name | 1-(3,5-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| PubChem CID | 129319908 |
| Molecular Formula | C12H11F3O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione |
| SMILES | COc1cc(OC)cc(C(=O)CC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3O4/c1-18-8-3-7(4-9(5-8)19-2)10(16)6-11(17)12(13,14)15/h3-5H,6H2,1-2H3 |
| InChIKey | YXZAPIKIWLGQRS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|