C9H9FO3 — CID 102051744
3,5-dimethoxybenzoyl fluoride (PubChem CID 102051744) has the molecular formula C9H9FO3 and a molecular weight of 184.17 g/mol. Its IUPAC name is 3,5-dimethoxybenzoyl fluoride.
| Compound Name | 3,5-dimethoxybenzoyl fluoride |
|---|---|
| PubChem CID | 102051744 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 3,5-dimethoxybenzoyl fluoride |
| SMILES | COc1cc(OC)cc(C(=O)F)c1 |
| InChI | InChI=1S/C9H9FO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3 |
| InChIKey | VXZNDCFSGAKGDI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|