3,5-dimethoxybenzoyl fluoride

C9H9FO3 — CID 102051744

IUPAC3,5-dimethoxybenzoyl fluoride
SMILESCOc1cc(OC)cc(C(=O)F)c1
InChIInChI=1S/C9H9FO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3
InChIKeyVXZNDCFSGAKGDI-UHFFFAOYSA-N
MW184.17 g/mol
LogP1.81
Rot. Bonds3

About 3,5-dimethoxybenzoyl fluoride

3,5-dimethoxybenzoyl fluoride (PubChem CID 102051744) has the molecular formula C9H9FO3 and a molecular weight of 184.17 g/mol. Its IUPAC name is 3,5-dimethoxybenzoyl fluoride.

Molecular Properties

Compound Name3,5-dimethoxybenzoyl fluoride
PubChem CID102051744
Molecular FormulaC9H9FO3
Molecular Weight184.17 g/mol
Exact Mass184.05
IUPAC Name3,5-dimethoxybenzoyl fluoride
SMILESCOc1cc(OC)cc(C(=O)F)c1
InChIInChI=1S/C9H9FO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3
InChIKeyVXZNDCFSGAKGDI-UHFFFAOYSA-N
XLogP1.81
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.17
LogP ≤ 51.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3,5-dimethoxybenzoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethoxybenzoyl fluoride?
The IUPAC name of 3,5-dimethoxybenzoyl fluoride (CID 102051744) is 3,5-dimethoxybenzoyl fluoride.
What is the SMILES notation for 3,5-dimethoxybenzoyl fluoride?
The canonical SMILES for 3,5-dimethoxybenzoyl fluoride is COc1cc(OC)cc(C(=O)F)c1.
What is the InChIKey of 3,5-dimethoxybenzoyl fluoride?
The InChIKey is VXZNDCFSGAKGDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3.
What are the key properties of 3,5-dimethoxybenzoyl fluoride?
3,5-dimethoxybenzoyl fluoride has a molecular weight of 184.17 g/mol, XLogP of 1.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethoxybenzoyl fluoride is sourced from PubChem (CID 102051744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).