C11H15NO3 — CID 4286127
N-ethyl-3,5-dimethoxybenzamide (PubChem CID 4286127) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is N-ethyl-3,5-dimethoxybenzamide.
| Compound Name | N-ethyl-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 4286127 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-ethyl-3,5-dimethoxybenzamide |
| SMILES | CCNC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C11H15NO3/c1-4-12-11(13)8-5-9(14-2)7-10(6-8)15-3/h5-7H,4H2,1-3H3,(H,12,13) |
| InChIKey | PZAHPEGVTGAXLS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |