C12H15NO6 — CID 66167276
3-[(3,5-dimethoxybenzoyl)amino]-2-hydroxypropanoic acid (PubChem CID 66167276) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is 3-[(3,5-dimethoxybenzoyl)amino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(3,5-dimethoxybenzoyl)amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66167276 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3-[(3,5-dimethoxybenzoyl)amino]-2-hydroxypropanoic acid |
| SMILES | COc1cc(OC)cc(C(=O)NCC(O)C(=O)O)c1 |
| InChI | InChI=1S/C12H15NO6/c1-18-8-3-7(4-9(5-8)19-2)11(15)13-6-10(14)12(16)17/h3-5,10,14H,6H2,1-2H3,(H,13,15)(H,16,17) |
| InChIKey | AMDVDGWVARIYOK-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |