C18H21NO4 — CID 56765275
N-(2-hydroxy-3-phenylpropyl)-3,5-dimethoxybenzamide (PubChem CID 56765275) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-(2-hydroxy-3-phenylpropyl)-3,5-dimethoxybenzamide.
| Compound Name | N-(2-hydroxy-3-phenylpropyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 56765275 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-(2-hydroxy-3-phenylpropyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC(O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C18H21NO4/c1-22-16-9-14(10-17(11-16)23-2)18(21)19-12-15(20)8-13-6-4-3-5-7-13/h3-7,9-11,15,20H,8,12H2,1-2H3,(H,19,21) |
| InChIKey | DQRGGXTXXGCZJA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |