C11H16N2O4 — CID 92931838
N-(2-aminooxyethyl)-3,5-dimethoxybenzamide (PubChem CID 92931838) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-(2-aminooxyethyl)-3,5-dimethoxybenzamide.
| Compound Name | N-(2-aminooxyethyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 92931838 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-(2-aminooxyethyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCON)c1 |
| InChI | InChI=1S/C11H16N2O4/c1-15-9-5-8(6-10(7-9)16-2)11(14)13-3-4-17-12/h5-7H,3-4,12H2,1-2H3,(H,13,14) |
| InChIKey | ULNMJFJZTPQXAG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|