C14H22N2O4 — CID 106243059
N-(3-amino-4-methoxybutyl)-3,5-dimethoxybenzamide (PubChem CID 106243059) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-(3-amino-4-methoxybutyl)-3,5-dimethoxybenzamide.
| Compound Name | N-(3-amino-4-methoxybutyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 106243059 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-(3-amino-4-methoxybutyl)-3,5-dimethoxybenzamide |
| SMILES | COCC(N)CCNC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C14H22N2O4/c1-18-9-11(15)4-5-16-14(17)10-6-12(19-2)8-13(7-10)20-3/h6-8,11H,4-5,9,15H2,1-3H3,(H,16,17) |
| InChIKey | QEKYDSCDEBBUFJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |