C17H24N4O5 — CID 170010863
1-N,3-N-bis(2-acetamidoethyl)-5-methoxybenzene-1,3-dicarboxamide (PubChem CID 170010863) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-N,3-N-bis(2-acetamidoethyl)-5-methoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-acetamidoethyl)-5-methoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 170010863 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-N,3-N-bis(2-acetamidoethyl)-5-methoxybenzene-1,3-dicarboxamide |
| SMILES | COc1cc(C(=O)NCCNC(C)=O)cc(C(=O)NCCNC(C)=O)c1 |
| InChI | InChI=1S/C17H24N4O5/c1-11(22)18-4-6-20-16(24)13-8-14(10-15(9-13)26-3)17(25)21-7-5-19-12(2)23/h8-10H,4-7H2,1-3H3,(H,18,22)(H,19,23)(H,20,24)(H,21,25) |
| InChIKey | IAXQBRKSFHVODQ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|