C13H20N2O5S — CID 7619023
N-[2-(ethylsulfamoyl)ethyl]-3,5-dimethoxybenzamide (PubChem CID 7619023) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is N-[2-(ethylsulfamoyl)ethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(ethylsulfamoyl)ethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 7619023 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-[2-(ethylsulfamoyl)ethyl]-3,5-dimethoxybenzamide |
| SMILES | CCNS(=O)(=O)CCNC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C13H20N2O5S/c1-4-15-21(17,18)6-5-14-13(16)10-7-11(19-2)9-12(8-10)20-3/h7-9,15H,4-6H2,1-3H3,(H,14,16) |
| InChIKey | FQSYJHWBVRBUCR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |