C12H18N2O5S — CID 7619022
3,5-dimethoxy-N-[2-(methylsulfamoyl)ethyl]benzamide (PubChem CID 7619022) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[2-(methylsulfamoyl)ethyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[2-(methylsulfamoyl)ethyl]benzamide |
|---|---|
| PubChem CID | 7619022 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3,5-dimethoxy-N-[2-(methylsulfamoyl)ethyl]benzamide |
| SMILES | CNS(=O)(=O)CCNC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C12H18N2O5S/c1-13-20(16,17)5-4-14-12(15)9-6-10(18-2)8-11(7-9)19-3/h6-8,13H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | WQCNGCHFCFSXCG-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |