C10H14N2O3S2 — CID 114175650
N-[2-(methylsulfamoyl)ethyl]-4-sulfanylbenzamide (PubChem CID 114175650) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-[2-(methylsulfamoyl)ethyl]-4-sulfanylbenzamide.
| Compound Name | N-[2-(methylsulfamoyl)ethyl]-4-sulfanylbenzamide |
|---|---|
| PubChem CID | 114175650 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N-[2-(methylsulfamoyl)ethyl]-4-sulfanylbenzamide |
| SMILES | CNS(=O)(=O)CCNC(=O)c1ccc(S)cc1 |
| InChI | InChI=1S/C10H14N2O3S2/c1-11-17(14,15)7-6-12-10(13)8-2-4-9(16)5-3-8/h2-5,11,16H,6-7H2,1H3,(H,12,13) |
| InChIKey | FYAOJNAWCXRIFK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|