C11H14N2O5S — CID 106341777
4-[2-(methylsulfamoyl)ethylcarbamoyl]benzoic acid (PubChem CID 106341777) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-[2-(methylsulfamoyl)ethylcarbamoyl]benzoic acid.
| Compound Name | 4-[2-(methylsulfamoyl)ethylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 106341777 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 4-[2-(methylsulfamoyl)ethylcarbamoyl]benzoic acid |
| SMILES | CNS(=O)(=O)CCNC(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C11H14N2O5S/c1-12-19(17,18)7-6-13-10(14)8-2-4-9(5-3-8)11(15)16/h2-5,12H,6-7H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | BUZKBIZWUJRGLV-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |