C9H12FN3O3S — CID 102685105
6-fluoro-N-[2-(methylsulfamoyl)ethyl]pyridine-3-carboxamide (PubChem CID 102685105) has the molecular formula C9H12FN3O3S and a molecular weight of 261.28 g/mol. Its IUPAC name is 6-fluoro-N-[2-(methylsulfamoyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-[2-(methylsulfamoyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 102685105 |
| Molecular Formula | C9H12FN3O3S |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 6-fluoro-N-[2-(methylsulfamoyl)ethyl]pyridine-3-carboxamide |
| SMILES | CNS(=O)(=O)CCNC(=O)c1ccc(F)nc1 |
| InChI | InChI=1S/C9H12FN3O3S/c1-11-17(15,16)5-4-12-9(14)7-2-3-8(10)13-6-7/h2-3,6,11H,4-5H2,1H3,(H,12,14) |
| InChIKey | DBUDLHJLFMSURK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|