C9H11FN2O2 — CID 63980450
6-fluoro-N-(2-hydroxypropyl)pyridine-3-carboxamide (PubChem CID 63980450) has the molecular formula C9H11FN2O2 and a molecular weight of 198.20 g/mol. Its IUPAC name is 6-fluoro-N-(2-hydroxypropyl)pyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-(2-hydroxypropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63980450 |
| Molecular Formula | C9H11FN2O2 |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 6-fluoro-N-(2-hydroxypropyl)pyridine-3-carboxamide |
| SMILES | CC(O)CNC(=O)c1ccc(F)nc1 |
| InChI | InChI=1S/C9H11FN2O2/c1-6(13)4-12-9(14)7-2-3-8(10)11-5-7/h2-3,5-6,13H,4H2,1H3,(H,12,14) |
| InChIKey | NDRIBJBPEGRGRH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|