C21H18F2N4O2 — CID 154837884
6-fluoro-N-[[4-[1-[(6-fluoropyridine-3-carbonyl)amino]ethyl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 154837884) has the molecular formula C21H18F2N4O2 and a molecular weight of 396.40 g/mol. Its IUPAC name is 6-fluoro-N-[[4-[1-[(6-fluoropyridine-3-carbonyl)amino]ethyl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-[[4-[1-[(6-fluoropyridine-3-carbonyl)amino]ethyl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154837884 |
| Molecular Formula | C21H18F2N4O2 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 6-fluoro-N-[[4-[1-[(6-fluoropyridine-3-carbonyl)amino]ethyl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1ccc(F)nc1)c1ccc(CNC(=O)c2ccc(F)nc2)cc1 |
| InChI | InChI=1S/C21H18F2N4O2/c1-13(27-21(29)17-7-9-19(23)25-12-17)15-4-2-14(3-5-15)10-26-20(28)16-6-8-18(22)24-11-16/h2-9,11-13H,10H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | QLOIJZQSRZMCIJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|