C14H22FN3O — CID 63979376
6-fluoro-N-[4-[methyl(propan-2-yl)amino]butyl]pyridine-3-carboxamide (PubChem CID 63979376) has the molecular formula C14H22FN3O and a molecular weight of 267.35 g/mol. Its IUPAC name is 6-fluoro-N-[4-[methyl(propan-2-yl)amino]butyl]pyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-[4-[methyl(propan-2-yl)amino]butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63979376 |
| Molecular Formula | C14H22FN3O |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 6-fluoro-N-[4-[methyl(propan-2-yl)amino]butyl]pyridine-3-carboxamide |
| SMILES | CC(C)N(C)CCCCNC(=O)c1ccc(F)nc1 |
| InChI | InChI=1S/C14H22FN3O/c1-11(2)18(3)9-5-4-8-16-14(19)12-6-7-13(15)17-10-12/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,16,19) |
| InChIKey | ADQIFHOAFWTQDZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|